C20H12ClN7S — CID 3504805
5-[1-(4-chlorophenyl)tetrazol-5-yl]-2-pyridin-2-yl-4-thiophen-2-ylpyrimidine (PubChem CID 3504805) has the molecular formula C20H12ClN7S and a molecular weight of 417.89 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)tetrazol-5-yl]-2-pyridin-2-yl-4-thiophen-2-ylpyrimidine.
| Compound Name | 5-[1-(4-chlorophenyl)tetrazol-5-yl]-2-pyridin-2-yl-4-thiophen-2-ylpyrimidine |
|---|---|
| PubChem CID | 3504805 |
| Molecular Formula | C20H12ClN7S |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 5-[1-(4-chlorophenyl)tetrazol-5-yl]-2-pyridin-2-yl-4-thiophen-2-ylpyrimidine |
| SMILES | Clc1ccc(-n2nnnc2-c2cnc(-c3ccccn3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C20H12ClN7S/c21-13-6-8-14(9-7-13)28-20(25-26-27-28)15-12-23-19(16-4-1-2-10-22-16)24-18(15)17-5-3-11-29-17/h1-12H |
| InChIKey | JGJORFRWUOJXAS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |