C9H8N2O3S — CID 3505099
5-cyano-6-ethylsulfanyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 3505099) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is 5-cyano-6-ethylsulfanyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-cyano-6-ethylsulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 3505099 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 5-cyano-6-ethylsulfanyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CCSc1[nH]c(=O)c(C(=O)O)cc1C#N |
| InChI | InChI=1S/C9H8N2O3S/c1-2-15-8-5(4-10)3-6(9(13)14)7(12)11-8/h3H,2H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | HZCALJKGKPTQQZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |