C18H13F2N3O3 — CID 35064242
N'-[3-(difluoromethoxy)benzoyl]quinoline-2-carbohydrazide (PubChem CID 35064242) has the molecular formula C18H13F2N3O3 and a molecular weight of 357.32 g/mol. Its IUPAC name is N'-[3-(difluoromethoxy)benzoyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[3-(difluoromethoxy)benzoyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 35064242 |
| Molecular Formula | C18H13F2N3O3 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N'-[3-(difluoromethoxy)benzoyl]quinoline-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2ccccc2n1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H13F2N3O3/c19-18(20)26-13-6-3-5-12(10-13)16(24)22-23-17(25)15-9-8-11-4-1-2-7-14(11)21-15/h1-10,18H,(H,22,24)(H,23,25) |
| InChIKey | OMONRSXVHCYARA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|