C16H23N3O — CID 3506463
1-(benzotriazol-1-yl)-4,6,6-trimethylheptan-2-one (PubChem CID 3506463) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-4,6,6-trimethylheptan-2-one.
| Compound Name | 1-(benzotriazol-1-yl)-4,6,6-trimethylheptan-2-one |
|---|---|
| PubChem CID | 3506463 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-(benzotriazol-1-yl)-4,6,6-trimethylheptan-2-one |
| SMILES | CC(CC(=O)Cn1nnc2ccccc21)CC(C)(C)C |
| InChI | InChI=1S/C16H23N3O/c1-12(10-16(2,3)4)9-13(20)11-19-15-8-6-5-7-14(15)17-18-19/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | CHTTUDGJKMAECZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |