C21H15F3N6O2 — CID 35066330
N'-[5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonyl]quinoline-2-carbohydrazide (PubChem CID 35066330) has the molecular formula C21H15F3N6O2 and a molecular weight of 440.39 g/mol. Its IUPAC name is N'-[5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 35066330 |
| Molecular Formula | C21H15F3N6O2 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N'-[5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonyl]quinoline-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc3ccccc3n2)cnn1-c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H15F3N6O2/c1-12-15(11-26-30(12)18-9-7-14(10-25-18)21(22,23)24)19(31)28-29-20(32)17-8-6-13-4-2-3-5-16(13)27-17/h2-11H,1H3,(H,28,31)(H,29,32) |
| InChIKey | JZHNUGPYJFXYBT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|