C20H17F3N6OS — CID 55635689
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 55635689) has the molecular formula C20H17F3N6OS and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55635689 |
| Molecular Formula | C20H17F3N6OS |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCNc2nc3ccccc3s2)cnn1-c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H17F3N6OS/c1-12-14(11-27-29(12)17-7-6-13(10-26-17)20(21,22)23)18(30)24-8-9-25-19-28-15-4-2-3-5-16(15)31-19/h2-7,10-11H,8-9H2,1H3,(H,24,30)(H,25,28) |
| InChIKey | NGVXCYAQBYRRDZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|