C29H20ClN5O4 — CID 3506901
2-(4-chlorophenyl)-6-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylideneamino]-3,8-dioxopyrido[3,4-c]pyridazine-4-carbonitrile (PubChem CID 3506901) has the molecular formula C29H20ClN5O4 and a molecular weight of 537.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylideneamino]-3,8-dioxopyrido[3,4-c]pyridazine-4-carbonitrile.
| Compound Name | 2-(4-chlorophenyl)-6-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylideneamino]-3,8-dioxopyrido[3,4-c]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 3506901 |
| Molecular Formula | C29H20ClN5O4 |
| Molecular Weight | 537.96 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 2-(4-chlorophenyl)-6-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylideneamino]-3,8-dioxopyrido[3,4-c]pyridazine-4-carbonitrile |
| SMILES | COc1ccccc1C=Nn1c(-c2ccccc2OC)cc2c(C#N)c(=O)n(-c3ccc(Cl)cc3)nc2c1=O |
| InChI | InChI=1S/C29H20ClN5O4/c1-38-25-9-5-3-7-18(25)17-32-35-24(21-8-4-6-10-26(21)39-2)15-22-23(16-31)28(36)34(33-27(22)29(35)37)20-13-11-19(30)12-14-20/h3-15,17H,1-2H3 |
| InChIKey | AMUKMJTZUDBKME-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 111.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.96 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|