C20H18Cl2FN3O2 — CID 3507391
4-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-1-(4-fluorophenyl)pyrazolidine-3,5-dione (PubChem CID 3507391) has the molecular formula C20H18Cl2FN3O2 and a molecular weight of 422.29 g/mol. Its IUPAC name is 4-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-1-(4-fluorophenyl)pyrazolidine-3,5-dione.
| Compound Name | 4-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-1-(4-fluorophenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 3507391 |
| Molecular Formula | C20H18Cl2FN3O2 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 4-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-1-(4-fluorophenyl)pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(F)cc2)C(=O)C1=Cc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C20H18Cl2FN3O2/c21-9-11-25(12-10-22)16-5-1-14(2-6-16)13-18-19(27)24-26(20(18)28)17-7-3-15(23)4-8-17/h1-8,13H,9-12H2,(H,24,27) |
| InChIKey | FYYVEUWPLUELDT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|