C18H15ClN4O3S — CID 35076867
N'-[2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetyl]pyridine-2-carbohydrazide (PubChem CID 35076867) has the molecular formula C18H15ClN4O3S and a molecular weight of 402.86 g/mol. Its IUPAC name is N'-[2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 35076867 |
| Molecular Formula | C18H15ClN4O3S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N'-[2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]acetyl]pyridine-2-carbohydrazide |
| SMILES | O=C(Cc1csc(COc2ccc(Cl)cc2)n1)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C18H15ClN4O3S/c19-12-4-6-14(7-5-12)26-10-17-21-13(11-27-17)9-16(24)22-23-18(25)15-3-1-2-8-20-15/h1-8,11H,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | QHNCPMGZPNDMOD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|