C22H22ClN3O4S — CID 35819751
2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N'-[2-(2,5-dimethylphenoxy)acetyl]acetohydrazide (PubChem CID 35819751) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N'-[2-(2,5-dimethylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N'-[2-(2,5-dimethylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 35819751 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-N'-[2-(2,5-dimethylphenoxy)acetyl]acetohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)Cc2csc(COc3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C22H22ClN3O4S/c1-14-3-4-15(2)19(9-14)30-11-21(28)26-25-20(27)10-17-13-31-22(24-17)12-29-18-7-5-16(23)6-8-18/h3-9,13H,10-12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | GNHTWMSFPHBIPG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|