C19H16Cl3N3O2S — CID 27895579
2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 27895579) has the molecular formula C19H16Cl3N3O2S and a molecular weight of 456.78 g/mol. Its IUPAC name is 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 27895579 |
| Molecular Formula | C19H16Cl3N3O2S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | Cc1ccc(OCc2nc(CC(=O)NNc3c(Cl)cc(Cl)cc3Cl)cs2)cc1 |
| InChI | InChI=1S/C19H16Cl3N3O2S/c1-11-2-4-14(5-3-11)27-9-18-23-13(10-28-18)8-17(26)24-25-19-15(21)6-12(20)7-16(19)22/h2-7,10,25H,8-9H2,1H3,(H,24,26) |
| InChIKey | UZZUDVRMCKUXJO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|