C27H27N3OS — CID 35080198
2-[2-[(R)-phenyl(phenylsulfanyl)methyl]benzimidazol-1-yl]-1-piperidin-1-ylethanone (PubChem CID 35080198) has the molecular formula C27H27N3OS and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-[2-[(R)-phenyl(phenylsulfanyl)methyl]benzimidazol-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-[(R)-phenyl(phenylsulfanyl)methyl]benzimidazol-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 35080198 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[2-[(R)-phenyl(phenylsulfanyl)methyl]benzimidazol-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(Cn1c([C@H](Sc2ccccc2)c2ccccc2)nc2ccccc21)N1CCCCC1 |
| InChI | InChI=1S/C27H27N3OS/c31-25(29-18-10-3-11-19-29)20-30-24-17-9-8-16-23(24)28-27(30)26(21-12-4-1-5-13-21)32-22-14-6-2-7-15-22/h1-2,4-9,12-17,26H,3,10-11,18-20H2/t26-/m1/s1 |
| InChIKey | QOTFOFVXUMDSHJ-AREMUKBSSA-N |
| XLogP | 5.93 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |