C29H23N3O9S — CID 3510102
2-methoxyethyl 5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3510102) has the molecular formula C29H23N3O9S and a molecular weight of 589.58 g/mol. Its IUPAC name is 2-methoxyethyl 5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3510102 |
| Molecular Formula | C29H23N3O9S |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | 2-methoxyethyl 5-[4-(furan-2-carbonyloxy)phenyl]-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=c2sc(=Cc3ccc([N+](=O)[O-])cc3)c(=O)n2C1c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C29H23N3O9S/c1-17-24(28(35)40-15-14-38-2)25(19-7-11-21(12-8-19)41-27(34)22-4-3-13-39-22)31-26(33)23(42-29(31)30-17)16-18-5-9-20(10-6-18)32(36)37/h3-13,16,25H,14-15H2,1-2H3 |
| InChIKey | JJHODRHYZNZABE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 152.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|