C33H31N3O6S — CID 6119819
benzyl (2Z)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5-(4-pentoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 6119819) has the molecular formula C33H31N3O6S and a molecular weight of 597.69 g/mol. Its IUPAC name is benzyl (2Z)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5-(4-pentoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | benzyl (2Z)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5-(4-pentoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 6119819 |
| Molecular Formula | C33H31N3O6S |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | benzyl (2Z)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5-(4-pentoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCOc1ccc(C2C(C(=O)OCc3ccccc3)=C(C)N=c3s/c(=C\c4ccc([N+](=O)[O-])cc4)c(=O)n32)cc1 |
| InChI | InChI=1S/C33H31N3O6S/c1-3-4-8-19-41-27-17-13-25(14-18-27)30-29(32(38)42-21-24-9-6-5-7-10-24)22(2)34-33-35(30)31(37)28(43-33)20-23-11-15-26(16-12-23)36(39)40/h5-7,9-18,20,30H,3-4,8,19,21H2,1-2H3/b28-20- |
| InChIKey | BVLDWOGFJVEDOC-RRAHZORUSA-N |
| XLogP | 5.46 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|