C21H25N5O5 — CID 3510277
4-ethyl-3-[1-[2-[3-(4-nitrophenyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 3510277) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-ethyl-3-[1-[2-[3-(4-nitrophenyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 4-ethyl-3-[1-[2-[3-(4-nitrophenyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3510277 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-ethyl-3-[1-[2-[3-(4-nitrophenyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | CCC1COC(=O)N1C1CCN(C(=O)Cn2ccc(-c3ccc([N+](=O)[O-])cc3)n2)CC1 |
| InChI | InChI=1S/C21H25N5O5/c1-2-16-14-31-21(28)25(16)17-7-10-23(11-8-17)20(27)13-24-12-9-19(22-24)15-3-5-18(6-4-15)26(29)30/h3-6,9,12,16-17H,2,7-8,10-11,13-14H2,1H3 |
| InChIKey | APCYAACCPUZRGZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|