C28H31N3O8S3 — CID 3510579
methyl 2-[2-[2-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3510579) has the molecular formula C28H31N3O8S3 and a molecular weight of 633.77 g/mol. Its IUPAC name is methyl 2-[2-[2-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[2-[2-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3510579 |
| Molecular Formula | C28H31N3O8S3 |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.13 |
| IUPAC Name | methyl 2-[2-[2-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N\C(=O)CS(=O)(=O)CC(=O)Nc2sc3c(c2C(=O)OCC)CCC(C)C3)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C28H31N3O8S3/c1-5-11-31-19-10-8-17(26(34)38-4)13-21(19)41-28(31)30-23(33)15-42(36,37)14-22(32)29-25-24(27(35)39-6-2)18-9-7-16(3)12-20(18)40-25/h5,8,10,13,16H,1,6-7,9,11-12,14-15H2,2-4H3,(H,29,32)/b30-28+ |
| InChIKey | PYOJIESWZYXFNR-SJCQXOIGSA-N |
| XLogP | 3.52 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|