C25H26FN3O6S3 — CID 4092586
methyl 2-[[2-[2-[(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4092586) has the molecular formula C25H26FN3O6S3 and a molecular weight of 579.70 g/mol. Its IUPAC name is methyl 2-[[2-[2-[(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[2-[(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4092586 |
| Molecular Formula | C25H26FN3O6S3 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | methyl 2-[[2-[2-[(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1/c(=N\C(=O)CS(=O)(=O)CC(=O)Nc2sc3c(c2C(=O)OC)CCC(C)C3)sc2cc(F)ccc21 |
| InChI | InChI=1S/C25H26FN3O6S3/c1-4-9-29-17-8-6-15(26)11-19(17)37-25(29)28-21(31)13-38(33,34)12-20(30)27-23-22(24(32)35-3)16-7-5-14(2)10-18(16)36-23/h4,6,8,11,14H,1,5,7,9-10,12-13H2,2-3H3,(H,27,30)/b28-25+ |
| InChIKey | OSZCQGFZJRLOGD-AZPGRJICSA-N |
| XLogP | 3.48 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|