C24H25N3O6S3 — CID 4624755
methyl 2-[[2-[2-oxo-2-[(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]ethyl]sulfonylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4624755) has the molecular formula C24H25N3O6S3 and a molecular weight of 547.68 g/mol. Its IUPAC name is methyl 2-[[2-[2-oxo-2-[(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]ethyl]sulfonylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[2-oxo-2-[(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]ethyl]sulfonylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4624755 |
| Molecular Formula | C24H25N3O6S3 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | methyl 2-[[2-[2-oxo-2-[(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]ethyl]sulfonylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1/c(=N\C(=O)CS(=O)(=O)CC(=O)Nc2sc3c(c2C(=O)OC)CCCC3)sc2ccccc21 |
| InChI | InChI=1S/C24H25N3O6S3/c1-3-12-27-16-9-5-7-11-18(16)35-24(27)26-20(29)14-36(31,32)13-19(28)25-22-21(23(30)33-2)15-8-4-6-10-17(15)34-22/h3,5,7,9,11H,1,4,6,8,10,12-14H2,2H3,(H,25,28)/b26-24+ |
| InChIKey | OEGCCVAMULKPFJ-SHHOIMCASA-N |
| XLogP | 3.10 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|