C28H21FN4O5S2 — CID 3511571
4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 3511571) has the molecular formula C28H21FN4O5S2 and a molecular weight of 576.63 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3511571 |
| Molecular Formula | C28H21FN4O5S2 |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(O)=C2C(=O)C(=O)N(c3nnc(SCc4ccccc4F)s3)C2c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C28H21FN4O5S2/c1-15-10-11-16(2)20(12-15)24(34)22-23(17-7-5-8-19(13-17)33(37)38)32(26(36)25(22)35)27-30-31-28(40-27)39-14-18-6-3-4-9-21(18)29/h3-13,23,34H,14H2,1-2H3 |
| InChIKey | LTPISEXHBCHIKF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|