C32H25N3O3S2 — CID 3536474
4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-phenylpyrrolidine-2,3-dione (PubChem CID 3536474) has the molecular formula C32H25N3O3S2 and a molecular weight of 563.70 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-phenylpyrrolidine-2,3-dione.
| Compound Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3536474 |
| Molecular Formula | C32H25N3O3S2 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-phenylpyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(O)=C2C(=O)C(=O)N(c3nnc(SCc4cccc5ccccc45)s3)C2c2ccccc2)c1 |
| InChI | InChI=1S/C32H25N3O3S2/c1-19-15-16-20(2)25(17-19)28(36)26-27(22-10-4-3-5-11-22)35(30(38)29(26)37)31-33-34-32(40-31)39-18-23-13-8-12-21-9-6-7-14-24(21)23/h3-17,27,36H,18H2,1-2H3 |
| InChIKey | MVCOJOMIAIYDQL-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|