C23H23N3O2 — CID 3511654
N-(furan-3-ylmethyl)-2-methyl-N-(3-phenylpropyl)-3H-benzimidazole-5-carboxamide (PubChem CID 3511654) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2-methyl-N-(3-phenylpropyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(furan-3-ylmethyl)-2-methyl-N-(3-phenylpropyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3511654 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(furan-3-ylmethyl)-2-methyl-N-(3-phenylpropyl)-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)N(CCCc3ccccc3)Cc3ccoc3)cc2[nH]1 |
| InChI | InChI=1S/C23H23N3O2/c1-17-24-21-10-9-20(14-22(21)25-17)23(27)26(15-19-11-13-28-16-19)12-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-11,13-14,16H,5,8,12,15H2,1H3,(H,24,25) |
| InChIKey | QQLVZQPUJTZCRD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |