C21H21Cl2NO4S — CID 35125738
N-[(2,4-dichlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enoxybenzamide (PubChem CID 35125738) has the molecular formula C21H21Cl2NO4S and a molecular weight of 454.38 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enoxybenzamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 35125738 |
| Molecular Formula | C21H21Cl2NO4S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N(Cc2ccc(Cl)cc2Cl)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H21Cl2NO4S/c1-2-10-28-19-7-4-15(5-8-19)21(25)24(18-9-11-29(26,27)14-18)13-16-3-6-17(22)12-20(16)23/h2-8,12,18H,1,9-11,13-14H2/t18-/m0/s1 |
| InChIKey | SKJGBWWTINGUGD-SFHVURJKSA-N |
| XLogP | 4.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|