C23H20Cl3N3O3S — CID 3512894
2,4,5-trichloro-N-[1-[(3-methoxyphenyl)methyl]-5,6-dimethylbenzimidazol-4-yl]benzenesulfonamide (PubChem CID 3512894) has the molecular formula C23H20Cl3N3O3S and a molecular weight of 524.86 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[1-[(3-methoxyphenyl)methyl]-5,6-dimethylbenzimidazol-4-yl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[1-[(3-methoxyphenyl)methyl]-5,6-dimethylbenzimidazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3512894 |
| Molecular Formula | C23H20Cl3N3O3S |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | 2,4,5-trichloro-N-[1-[(3-methoxyphenyl)methyl]-5,6-dimethylbenzimidazol-4-yl]benzenesulfonamide |
| SMILES | COc1cccc(Cn2cnc3c(NS(=O)(=O)c4cc(Cl)c(Cl)cc4Cl)c(C)c(C)cc32)c1 |
| InChI | InChI=1S/C23H20Cl3N3O3S/c1-13-7-20-23(27-12-29(20)11-15-5-4-6-16(8-15)32-3)22(14(13)2)28-33(30,31)21-10-18(25)17(24)9-19(21)26/h4-10,12,28H,11H2,1-3H3 |
| InChIKey | LQZDORKFWFFASB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|