C16H14Cl3N3O2S — CID 1474191
2,4,5-trichloro-N-(1,5,6-trimethylbenzimidazol-4-yl)benzenesulfonamide (PubChem CID 1474191) has the molecular formula C16H14Cl3N3O2S and a molecular weight of 418.73 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(1,5,6-trimethylbenzimidazol-4-yl)benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-(1,5,6-trimethylbenzimidazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 1474191 |
| Molecular Formula | C16H14Cl3N3O2S |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 2,4,5-trichloro-N-(1,5,6-trimethylbenzimidazol-4-yl)benzenesulfonamide |
| SMILES | Cc1cc2c(ncn2C)c(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C16H14Cl3N3O2S/c1-8-4-13-16(20-7-22(13)3)15(9(8)2)21-25(23,24)14-6-11(18)10(17)5-12(14)19/h4-7,21H,1-3H3 |
| InChIKey | ZQDROZJKBSHYIW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|