C20H17F3N2O5 — CID 35138686
(4S,5S,6S)-6-(1,3-benzodioxol-5-yl)-4-hydroxy-4-(4-methylphenyl)-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one (PubChem CID 35138686) has the molecular formula C20H17F3N2O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is (4S,5S,6S)-6-(1,3-benzodioxol-5-yl)-4-hydroxy-4-(4-methylphenyl)-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one.
| Compound Name | (4S,5S,6S)-6-(1,3-benzodioxol-5-yl)-4-hydroxy-4-(4-methylphenyl)-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 35138686 |
| Molecular Formula | C20H17F3N2O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (4S,5S,6S)-6-(1,3-benzodioxol-5-yl)-4-hydroxy-4-(4-methylphenyl)-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
| SMILES | Cc1ccc([C@]2(O)NC(=O)N[C@H](c3ccc4c(c3)OCO4)[C@@H]2C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O5/c1-10-2-5-12(6-3-10)19(28)15(17(26)20(21,22)23)16(24-18(27)25-19)11-4-7-13-14(8-11)30-9-29-13/h2-8,15-16,28H,9H2,1H3,(H2,24,25,27)/t15-,16-,19-/m1/s1 |
| InChIKey | PGXQFTHZEXPKDE-GPMSIDNRSA-N |
| XLogP | 2.67 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |