C18H14F4N2O3 — CID 7745838
(4R,5R,6R)-6-(2-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one (PubChem CID 7745838) has the molecular formula C18H14F4N2O3 and a molecular weight of 382.31 g/mol. Its IUPAC name is (4R,5R,6R)-6-(2-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6R)-6-(2-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 7745838 |
| Molecular Formula | C18H14F4N2O3 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (4R,5R,6R)-6-(2-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2F)[C@@H](C(=O)C(F)(F)F)[C@@](O)(c2ccccc2)N1 |
| InChI | InChI=1S/C18H14F4N2O3/c19-12-9-5-4-8-11(12)14-13(15(25)18(20,21)22)17(27,24-16(26)23-14)10-6-2-1-3-7-10/h1-9,13-14,27H,(H2,23,24,26)/t13-,14-,17-/m0/s1 |
| InChIKey | YGCFZXCKJVSFPF-ZQIUZPCESA-N |
| XLogP | 2.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |