C23H23ClF3N3O3S — CID 3514509
2-[4-chloro-3-(trifluoromethyl)phenyl]imino-3-ethyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide (PubChem CID 3514509) has the molecular formula C23H23ClF3N3O3S and a molecular weight of 513.97 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-3-ethyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-3-ethyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3514509 |
| Molecular Formula | C23H23ClF3N3O3S |
| Molecular Weight | 513.97 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-3-ethyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2CC(=O)N(CC)/C(=N/c3ccc(Cl)c(C(F)(F)F)c3)S2)cc1 |
| InChI | InChI=1S/C23H23ClF3N3O3S/c1-3-11-33-16-8-5-14(6-9-16)28-21(32)19-13-20(31)30(4-2)22(34-19)29-15-7-10-18(24)17(12-15)23(25,26)27/h5-10,12,19H,3-4,11,13H2,1-2H3,(H,28,32)/b29-22- |
| InChIKey | DXSCIYHPUVGPHN-IADYIPOJSA-N |
| XLogP | 6.13 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.97 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|