C27H26ClN3O3S — CID 3516238
[1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-chlorophenyl)-N'-[(4-methoxyphenyl)methyl]carbamimidothioate (PubChem CID 3516238) has the molecular formula C27H26ClN3O3S and a molecular weight of 508.04 g/mol. Its IUPAC name is [1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-chlorophenyl)-N'-[(4-methoxyphenyl)methyl]carbamimidothioate.
| Compound Name | [1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-chlorophenyl)-N'-[(4-methoxyphenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 3516238 |
| Molecular Formula | C27H26ClN3O3S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | [1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-chlorophenyl)-N'-[(4-methoxyphenyl)methyl]carbamimidothioate |
| SMILES | COc1ccc(C/N=C(\Nc2ccc(Cl)cc2)SC2CC(=O)N(c3ccc(C)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C27H26ClN3O3S/c1-17-4-13-23(18(2)14-17)31-25(32)15-24(26(31)33)35-27(30-21-9-7-20(28)8-10-21)29-16-19-5-11-22(34-3)12-6-19/h4-14,24H,15-16H2,1-3H3,(H,29,30) |
| InChIKey | SSRGIUKVBAKBKW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|