C27H28N4O5S2 — CID 138497021
[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-methylphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate (PubChem CID 138497021) has the molecular formula C27H28N4O5S2 and a molecular weight of 552.68 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-methylphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate.
| Compound Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-methylphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate |
|---|---|
| PubChem CID | 138497021 |
| Molecular Formula | C27H28N4O5S2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-methylphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate |
| SMILES | COc1ccc(N2C(=O)CC(S/C(=N\CCc3ccc(S(N)(=O)=O)cc3)Nc3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H28N4O5S2/c1-18-3-7-20(8-4-18)30-27(29-16-15-19-5-13-23(14-6-19)38(28,34)35)37-24-17-25(32)31(26(24)33)21-9-11-22(36-2)12-10-21/h3-14,24H,15-17H2,1-2H3,(H,29,30)(H2,28,34,35) |
| InChIKey | HVIFRFPEGHOMTJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|