C28H30N4O7S2 — CID 138497247
[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(2,5-dimethoxyphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate (PubChem CID 138497247) has the molecular formula C28H30N4O7S2 and a molecular weight of 598.70 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(2,5-dimethoxyphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate.
| Compound Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(2,5-dimethoxyphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate |
|---|---|
| PubChem CID | 138497247 |
| Molecular Formula | C28H30N4O7S2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N-(2,5-dimethoxyphenyl)-N'-[2-(4-sulfamoylphenyl)ethyl]carbamimidothioate |
| SMILES | COc1ccc(N2C(=O)CC(S/C(=N\CCc3ccc(S(N)(=O)=O)cc3)Nc3cc(OC)ccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C28H30N4O7S2/c1-37-20-8-6-19(7-9-20)32-26(33)17-25(27(32)34)40-28(31-23-16-21(38-2)10-13-24(23)39-3)30-15-14-18-4-11-22(12-5-18)41(29,35)36/h4-13,16,25H,14-15,17H2,1-3H3,(H,30,31)(H2,29,35,36) |
| InChIKey | ILFQBZCGONONTG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|