C25H17ClN2O4S2 — CID 3516966
3-[(2-chlorophenyl)methyl]-2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 3516966) has the molecular formula C25H17ClN2O4S2 and a molecular weight of 509.01 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3516966 |
| Molecular Formula | C25H17ClN2O4S2 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | O=C(CSc1nc2c(sc3ccccc32)c(=O)n1Cc1ccccc1Cl)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H17ClN2O4S2/c26-17-7-3-1-5-15(17)12-28-24(32)23-22(16-6-2-4-8-21(16)34-23)27-25(28)33-13-20(31)14-9-10-18(29)19(30)11-14/h1-11,29-30H,12-13H2 |
| InChIKey | BGTDUIOTCYNODR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|