C16H12BrFN4O3S2 — CID 35177209
N-[2-[(4-bromophenyl)sulfamoyl]-4-fluorophenyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 35177209) has the molecular formula C16H12BrFN4O3S2 and a molecular weight of 471.33 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)sulfamoyl]-4-fluorophenyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[2-[(4-bromophenyl)sulfamoyl]-4-fluorophenyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 35177209 |
| Molecular Formula | C16H12BrFN4O3S2 |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 469.95 |
| IUPAC Name | N-[2-[(4-bromophenyl)sulfamoyl]-4-fluorophenyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccc(F)cc1S(=O)(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrFN4O3S2/c1-9-15(26-22-20-9)16(23)19-13-7-4-11(18)8-14(13)27(24,25)21-12-5-2-10(17)3-6-12/h2-8,21H,1H3,(H,19,23) |
| InChIKey | BQSGRFHYGDVKPB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |