C17H15N5 — CID 35182091
N-[(1R)-1-phenylethyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 35182091) has the molecular formula C17H15N5 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 35182091 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | C[C@@H](Nc1nn2cnnc2c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C17H15N5/c1-12(13-7-3-2-4-8-13)19-16-14-9-5-6-10-15(14)17-20-18-11-22(17)21-16/h2-12H,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | LVQBGAWHKGARFI-GFCCVEGCSA-N |
| XLogP | 3.45 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |