C16H13N2O3- — CID 3519711
1-(2-methoxy-5-methylphenyl)benzimidazole-5-carboxylate (PubChem CID 3519711) has the molecular formula C16H13N2O3- and a molecular weight of 281.29 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)benzimidazole-5-carboxylate.
| Compound Name | 1-(2-methoxy-5-methylphenyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 3519711 |
| Molecular Formula | C16H13N2O3- |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)benzimidazole-5-carboxylate |
| SMILES | COc1ccc(C)cc1-n1cnc2cc(C(=O)[O-])ccc21 |
| InChI | InChI=1S/C16H14N2O3/c1-10-3-6-15(21-2)14(7-10)18-9-17-12-8-11(16(19)20)4-5-13(12)18/h3-9H,1-2H3,(H,19,20)/p-1 |
| InChIKey | NZLLEUCCGHTQBX-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |