C24H23N3O3 — CID 3594822
1-(2,5-dimethoxyphenyl)-N-(2-phenylethyl)benzimidazole-5-carboxamide (PubChem CID 3594822) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N-(2-phenylethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N-(2-phenylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3594822 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N-(2-phenylethyl)benzimidazole-5-carboxamide |
| SMILES | COc1ccc(OC)c(-n2cnc3cc(C(=O)NCCc4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C24H23N3O3/c1-29-19-9-11-23(30-2)22(15-19)27-16-26-20-14-18(8-10-21(20)27)24(28)25-13-12-17-6-4-3-5-7-17/h3-11,14-16H,12-13H2,1-2H3,(H,25,28) |
| InChIKey | FEGKVOXJHPADQD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |