C25H25N3O4 — CID 5235716
N-(2-phenylethyl)-1-(3,4,5-trimethoxyphenyl)benzimidazole-5-carboxamide (PubChem CID 5235716) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-(2-phenylethyl)-1-(3,4,5-trimethoxyphenyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2-phenylethyl)-1-(3,4,5-trimethoxyphenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 5235716 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-(2-phenylethyl)-1-(3,4,5-trimethoxyphenyl)benzimidazole-5-carboxamide |
| SMILES | COc1cc(-n2cnc3cc(C(=O)NCCc4ccccc4)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C25H25N3O4/c1-30-22-14-19(15-23(31-2)24(22)32-3)28-16-27-20-13-18(9-10-21(20)28)25(29)26-12-11-17-7-5-4-6-8-17/h4-10,13-16H,11-12H2,1-3H3,(H,26,29) |
| InChIKey | XDQPTYGMEIGBGJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |