C20H24N2O3S — CID 35202176
1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole (PubChem CID 35202176) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole.
| Compound Name | 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 35202176 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole |
| SMILES | CCCOc1cc(C)c(C)cc1S(=O)(=O)n1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H24N2O3S/c1-6-7-25-19-10-15(4)16(5)11-20(19)26(23,24)22-12-21-17-8-13(2)14(3)9-18(17)22/h8-12H,6-7H2,1-5H3 |
| InChIKey | VYVCFSBUXBLBFS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |