About 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole
1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole (PubChem CID 35202176) has the molecular formula C20H24N2O3S
and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole |
| PubChem CID | 35202176 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole |
| SMILES | CCCOc1cc(C)c(C)cc1S(=O)(=O)n1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H24N2O3S/c1-6-7-25-19-10-15(4)16(5)11-20(19)26(23,24)22-12-21-17-8-13(2)14(3)9-18(17)22/h8-12H,6-7H2,1-5H3 |
| InChIKey | VYVCFSBUXBLBFS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The IUPAC name of 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole (CID 35202176) is 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole is CCCOc1cc(C)c(C)cc1S(=O)(=O)n1cnc2cc(C)c(C)cc21.
What is the InChIKey of 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The InChIKey is VYVCFSBUXBLBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3S/c1-6-7-25-19-10-15(4)16(5)11-20(19)26(23,24)22-12-21-17-8-13(2)14(3)9-18(17)22/h8-12H,6-7H2,1-5H3.
What are the key properties of 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole?
1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole has a molecular weight of 372.49 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethyl-2-propoxyphenyl)sulfonyl-5,6-dimethylbenzimidazole is sourced from PubChem (CID 35202176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).