C14H16F3NO2S — CID 35240794
N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 35240794) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 35240794 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(SC(F)(F)F)cc1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H16F3NO2S/c1-9(12-3-2-8-20-12)18-13(19)10-4-6-11(7-5-10)21-14(15,16)17/h4-7,9,12H,2-3,8H2,1H3,(H,18,19)/t9-,12+/m1/s1 |
| InChIKey | RZLMOYZUVCDKLG-SKDRFNHKSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |