C12H18N2O5S — CID 35265676
5-(methylsulfamoyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]furan-2-carboxamide (PubChem CID 35265676) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 5-(methylsulfamoyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | 5-(methylsulfamoyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35265676 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-(methylsulfamoyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N[C@H](C)[C@H]2CCCO2)o1 |
| InChI | InChI=1S/C12H18N2O5S/c1-8(9-4-3-7-18-9)14-12(15)10-5-6-11(19-10)20(16,17)13-2/h5-6,8-9,13H,3-4,7H2,1-2H3,(H,14,15)/t8-,9-/m1/s1 |
| InChIKey | IPUYFUNCGLMOER-RKDXNWHRSA-N |
| XLogP | 0.49 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |