C22H21N3O3 — CID 35266981
6-methyl-1-phenyl-3-[(2S)-2-phenylmorpholine-4-carbonyl]pyridazin-4-one (PubChem CID 35266981) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 6-methyl-1-phenyl-3-[(2S)-2-phenylmorpholine-4-carbonyl]pyridazin-4-one.
| Compound Name | 6-methyl-1-phenyl-3-[(2S)-2-phenylmorpholine-4-carbonyl]pyridazin-4-one |
|---|---|
| PubChem CID | 35266981 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 6-methyl-1-phenyl-3-[(2S)-2-phenylmorpholine-4-carbonyl]pyridazin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)N2CCO[C@@H](c3ccccc3)C2)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H21N3O3/c1-16-14-19(26)21(23-25(16)18-10-6-3-7-11-18)22(27)24-12-13-28-20(15-24)17-8-4-2-5-9-17/h2-11,14,20H,12-13,15H2,1H3/t20-/m1/s1 |
| InChIKey | YWRVJHLUOAYSCC-HXUWFJFHSA-N |
| XLogP | 2.75 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |