C19H21N3O2 — CID 97067476
3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-6-methyl-1-phenylpyridazin-4-one (PubChem CID 97067476) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-6-methyl-1-phenylpyridazin-4-one.
| Compound Name | 3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-6-methyl-1-phenylpyridazin-4-one |
|---|---|
| PubChem CID | 97067476 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-6-methyl-1-phenylpyridazin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)N2C[C@H]3CCC[C@H]3C2)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H21N3O2/c1-13-10-17(23)18(20-22(13)16-8-3-2-4-9-16)19(24)21-11-14-6-5-7-15(14)12-21/h2-4,8-10,14-15H,5-7,11-12H2,1H3/t14-,15+ |
| InChIKey | HBUNHDYQGONOCK-GASCZTMLSA-N |
| XLogP | 2.41 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |