C15H18F3NO2 — CID 35272557
N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 35272557) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 35272557 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1cccc(C(F)(F)F)c1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H18F3NO2/c1-10(13-6-3-7-21-13)19-14(20)9-11-4-2-5-12(8-11)15(16,17)18/h2,4-5,8,10,13H,3,6-7,9H2,1H3,(H,19,20)/t10-,13+/m1/s1 |
| InChIKey | KJQVNMBDOSPILV-MFKMUULPSA-N |
| XLogP | 2.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |