C15H15F3NO4- — CID 6940387
(2S)-4-oxo-2-[(2S)-oxolan-2-yl]-4-[3-(trifluoromethyl)anilino]butanoate (PubChem CID 6940387) has the molecular formula C15H15F3NO4- and a molecular weight of 330.28 g/mol. Its IUPAC name is (2S)-4-oxo-2-[(2S)-oxolan-2-yl]-4-[3-(trifluoromethyl)anilino]butanoate.
| Compound Name | (2S)-4-oxo-2-[(2S)-oxolan-2-yl]-4-[3-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 6940387 |
| Molecular Formula | C15H15F3NO4- |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (2S)-4-oxo-2-[(2S)-oxolan-2-yl]-4-[3-(trifluoromethyl)anilino]butanoate |
| SMILES | O=C(C[C@H](C(=O)[O-])[C@@H]1CCCO1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NO4/c16-15(17,18)9-3-1-4-10(7-9)19-13(20)8-11(14(21)22)12-5-2-6-23-12/h1,3-4,7,11-12H,2,5-6,8H2,(H,19,20)(H,21,22)/p-1/t11-,12-/m0/s1 |
| InChIKey | WGAHLUJFRZDFHK-RYUDHWBXSA-M |
| XLogP | 1.58 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |