C15H14F2N2O2S — CID 35282758
2-[(3,4-difluorobenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 35282758) has the molecular formula C15H14F2N2O2S and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-[(3,4-difluorobenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide.
| Compound Name | 2-[(3,4-difluorobenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 35282758 |
| Molecular Formula | C15H14F2N2O2S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[(3,4-difluorobenzoyl)amino]-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | CC(C)c1cc(C(N)=O)c(NC(=O)c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C15H14F2N2O2S/c1-7(2)12-6-9(13(18)20)15(22-12)19-14(21)8-3-4-10(16)11(17)5-8/h3-7H,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | QTMPEEFLTVORCO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |