C14H16N2O2S2 — CID 35283019
2-[(3-methylthiophene-2-carbonyl)amino]-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 35283019) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[(3-methylthiophene-2-carbonyl)amino]-5-propan-2-ylthiophene-3-carboxamide.
| Compound Name | 2-[(3-methylthiophene-2-carbonyl)amino]-5-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 35283019 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-[(3-methylthiophene-2-carbonyl)amino]-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1sc(C(C)C)cc1C(N)=O |
| InChI | InChI=1S/C14H16N2O2S2/c1-7(2)10-6-9(12(15)17)14(20-10)16-13(18)11-8(3)4-5-19-11/h4-7H,1-3H3,(H2,15,17)(H,16,18) |
| InChIKey | XAGJZQNTOKNRBH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |