C29H31N3O4S — CID 3528815
4-ethoxy-N-[2-[3-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide (PubChem CID 3528815) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[3-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[3-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 3528815 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 4-ethoxy-N-[2-[3-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCn2cc(SCC(=O)Nc3ccccc3OCC)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H31N3O4S/c1-3-35-22-15-13-21(14-16-22)29(34)30-17-18-32-19-27(23-9-5-7-11-25(23)32)37-20-28(33)31-24-10-6-8-12-26(24)36-4-2/h5-16,19H,3-4,17-18,20H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | XNMJNQQZPSIDSQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |