C27H26N4O5S — CID 4649359
4-ethoxy-N-[2-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide (PubChem CID 4649359) has the molecular formula C27H26N4O5S and a molecular weight of 518.60 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 4649359 |
| Molecular Formula | C27H26N4O5S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 4-ethoxy-N-[2-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCn2cc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H26N4O5S/c1-2-36-22-13-7-19(8-14-22)27(33)28-15-16-30-17-25(23-5-3-4-6-24(23)30)37-18-26(32)29-20-9-11-21(12-10-20)31(34)35/h3-14,17H,2,15-16,18H2,1H3,(H,28,33)(H,29,32) |
| InChIKey | YHZCOCUUFXBYIX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 115.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|