C17H14F11NO — CID 3532407
N-(4-butan-2-ylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide (PubChem CID 3532407) has the molecular formula C17H14F11NO and a molecular weight of 457.28 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide.
| Compound Name | N-(4-butan-2-ylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3532407 |
| Molecular Formula | C17H14F11NO |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
| SMILES | CCC(C)c1ccc(NC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C17H14F11NO/c1-3-8(2)9-4-6-10(7-5-9)29-11(30)12(18)13(19,20)15(23,24)17(27,28)16(25,26)14(12,21)22/h4-8H,3H2,1-2H3,(H,29,30) |
| InChIKey | NDNUDVXJSNKLHR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|