C21H21N3O — CID 3533283
2-(furan-2-yl)-6-methyl-N-(4-propan-2-ylphenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 3533283) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-methyl-N-(4-propan-2-ylphenyl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(furan-2-yl)-6-methyl-N-(4-propan-2-ylphenyl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 3533283 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-(furan-2-yl)-6-methyl-N-(4-propan-2-ylphenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1ccc2nc(-c3ccco3)c(Nc3ccc(C(C)C)cc3)n2c1 |
| InChI | InChI=1S/C21H21N3O/c1-14(2)16-7-9-17(10-8-16)22-21-20(18-5-4-12-25-18)23-19-11-6-15(3)13-24(19)21/h4-14,22H,1-3H3 |
| InChIKey | BXEINGLXUVJFPU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_C(6)', 'substructure': 'N/A'} |
|---|