C29H41N3O5S2 — CID 3533370
N-cyclohexyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide (PubChem CID 3533370) has the molecular formula C29H41N3O5S2 and a molecular weight of 575.80 g/mol. Its IUPAC name is N-cyclohexyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 3533370 |
| Molecular Formula | C29H41N3O5S2 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | N-cyclohexyl-2-[7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3c(s2)CC2C(C)(CO)C(O)CCC2(C)C3CC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C29H41N3O5S2/c1-18-9-11-20(12-10-18)39(36,37)32-27-31-26-21(15-25(35)30-19-7-5-4-6-8-19)28(2)14-13-24(34)29(3,17-33)23(28)16-22(26)38-27/h9-12,19,21,23-24,33-34H,4-8,13-17H2,1-3H3,(H,30,35)(H,31,32) |
| InChIKey | UBKZYBDBQYEBEI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |